C22H15N5O3 — CID 67823917
1,4-diamino-N-(4-aminophenyl)-3-cyano-9,10-dioxoanthracene-2-carboxamide (PubChem CID 67823917) has the molecular formula C22H15N5O3 and a molecular weight of 397.39 g/mol. Its IUPAC name is 1,4-diamino-N-(4-aminophenyl)-3-cyano-9,10-dioxoanthracene-2-carboxamide.
| Compound Name | 1,4-diamino-N-(4-aminophenyl)-3-cyano-9,10-dioxoanthracene-2-carboxamide |
|---|---|
| PubChem CID | 67823917 |
| Molecular Formula | C22H15N5O3 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 1,4-diamino-N-(4-aminophenyl)-3-cyano-9,10-dioxoanthracene-2-carboxamide |
| SMILES | N#Cc1c(N)c2c(c(N)c1C(=O)Nc1ccc(N)cc1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H15N5O3/c23-9-14-15(22(30)27-11-7-5-10(24)6-8-11)19(26)17-16(18(14)25)20(28)12-3-1-2-4-13(12)21(17)29/h1-8H,24-26H2,(H,27,30) |
| InChIKey | BOAVXTKKFDYTIX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 165.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|