C23H13ClN2O3 — CID 1090906
N-(4-chlorophenyl)-6,11-dioxonaphtho[2,3-b]indolizine-12-carboxamide (PubChem CID 1090906) has the molecular formula C23H13ClN2O3 and a molecular weight of 400.82 g/mol. Its IUPAC name is N-(4-chlorophenyl)-6,11-dioxonaphtho[2,3-b]indolizine-12-carboxamide.
| Compound Name | N-(4-chlorophenyl)-6,11-dioxonaphtho[2,3-b]indolizine-12-carboxamide |
|---|---|
| PubChem CID | 1090906 |
| Molecular Formula | C23H13ClN2O3 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | N-(4-chlorophenyl)-6,11-dioxonaphtho[2,3-b]indolizine-12-carboxamide |
| SMILES | O=C1c2ccccc2C(=O)c2c1c(C(=O)Nc1ccc(Cl)cc1)c1ccccn21 |
| InChI | InChI=1S/C23H13ClN2O3/c24-13-8-10-14(11-9-13)25-23(29)18-17-7-3-4-12-26(17)20-19(18)21(27)15-5-1-2-6-16(15)22(20)28/h1-12H,(H,25,29) |
| InChIKey | DEBCGOYLAVTZMJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|