C27H14ClNO3 — CID 57333331
12-(4-chlorobenzoyl)-1-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-2(11),4,6,8,12,14,16,18,20-nonaene-3,10-dione (PubChem CID 57333331) has the molecular formula C27H14ClNO3 and a molecular weight of 435.87 g/mol. Its IUPAC name is 12-(4-chlorobenzoyl)-1-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-2(11),4,6,8,12,14,16,18,20-nonaene-3,10-dione.
| Compound Name | 12-(4-chlorobenzoyl)-1-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-2(11),4,6,8,12,14,16,18,20-nonaene-3,10-dione |
|---|---|
| PubChem CID | 57333331 |
| Molecular Formula | C27H14ClNO3 |
| Molecular Weight | 435.87 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 12-(4-chlorobenzoyl)-1-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-2(11),4,6,8,12,14,16,18,20-nonaene-3,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1c(C(=O)c1ccc(Cl)cc1)c1c3ccccc3ccn21 |
| InChI | InChI=1S/C27H14ClNO3/c28-17-11-9-16(10-12-17)25(30)21-22-24(27(32)20-8-4-3-7-19(20)26(22)31)29-14-13-15-5-1-2-6-18(15)23(21)29/h1-14H |
| InChIKey | WZPZGRCUTUBLCN-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 55.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.87 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|