C20H15NO3 — CID 7728366
12-acetyl-2-ethylnaphtho[2,3-b]indolizine-6,11-dione (PubChem CID 7728366) has the molecular formula C20H15NO3 and a molecular weight of 317.34 g/mol. Its IUPAC name is 12-acetyl-2-ethylnaphtho[2,3-b]indolizine-6,11-dione.
| Compound Name | 12-acetyl-2-ethylnaphtho[2,3-b]indolizine-6,11-dione |
|---|---|
| PubChem CID | 7728366 |
| Molecular Formula | C20H15NO3 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 12-acetyl-2-ethylnaphtho[2,3-b]indolizine-6,11-dione |
| SMILES | CCc1ccn2c3c(c(C(C)=O)c2c1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C20H15NO3/c1-3-12-8-9-21-15(10-12)16(11(2)22)17-18(21)20(24)14-7-5-4-6-13(14)19(17)23/h4-10H,3H2,1-2H3 |
| InChIKey | ISMSIMLCWRNVSL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|