C28H17NO3 — CID 57333081
2-methyl-12-(naphthalene-2-carbonyl)naphtho[2,3-b]indolizine-6,11-dione (PubChem CID 57333081) has the molecular formula C28H17NO3 and a molecular weight of 415.45 g/mol. Its IUPAC name is 2-methyl-12-(naphthalene-2-carbonyl)naphtho[2,3-b]indolizine-6,11-dione.
| Compound Name | 2-methyl-12-(naphthalene-2-carbonyl)naphtho[2,3-b]indolizine-6,11-dione |
|---|---|
| PubChem CID | 57333081 |
| Molecular Formula | C28H17NO3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 2-methyl-12-(naphthalene-2-carbonyl)naphtho[2,3-b]indolizine-6,11-dione |
| SMILES | Cc1ccn2c3c(c(C(=O)c4ccc5ccccc5c4)c2c1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C28H17NO3/c1-16-12-13-29-22(14-16)23(26(30)19-11-10-17-6-2-3-7-18(17)15-19)24-25(29)28(32)21-9-5-4-8-20(21)27(24)31/h2-15H,1H3 |
| InChIKey | IMXLTGICXREPEU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 55.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|