C24H15NO4 — CID 162767300
8-methoxy-5-(naphthalene-2-carbonyl)pyrrolo[1,2-b]isoquinoline-6,9-dione (PubChem CID 162767300) has the molecular formula C24H15NO4 and a molecular weight of 381.39 g/mol. Its IUPAC name is 8-methoxy-5-(naphthalene-2-carbonyl)pyrrolo[1,2-b]isoquinoline-6,9-dione.
| Compound Name | 8-methoxy-5-(naphthalene-2-carbonyl)pyrrolo[1,2-b]isoquinoline-6,9-dione |
|---|---|
| PubChem CID | 162767300 |
| Molecular Formula | C24H15NO4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 8-methoxy-5-(naphthalene-2-carbonyl)pyrrolo[1,2-b]isoquinoline-6,9-dione |
| SMILES | COC1=CC(=O)c2c(cc3cccn3c2C(=O)c2ccc3ccccc3c2)C1=O |
| InChI | InChI=1S/C24H15NO4/c1-29-20-13-19(26)21-18(24(20)28)12-17-7-4-10-25(17)22(21)23(27)16-9-8-14-5-2-3-6-15(14)11-16/h2-13H,1H3 |
| InChIKey | KYVQTJLBIDBPRC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|