C27H31NO5 — CID 66993154
2-tert-butyl-2-[3-(4-methoxybenzoyl)indolizin-2-yl]-4,4-dimethyl-3-oxopentanoic acid (PubChem CID 66993154) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is 2-tert-butyl-2-[3-(4-methoxybenzoyl)indolizin-2-yl]-4,4-dimethyl-3-oxopentanoic acid.
| Compound Name | 2-tert-butyl-2-[3-(4-methoxybenzoyl)indolizin-2-yl]-4,4-dimethyl-3-oxopentanoic acid |
|---|---|
| PubChem CID | 66993154 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 2-tert-butyl-2-[3-(4-methoxybenzoyl)indolizin-2-yl]-4,4-dimethyl-3-oxopentanoic acid |
| SMILES | COc1ccc(C(=O)c2c(C(C(=O)O)(C(=O)C(C)(C)C)C(C)(C)C)cc3ccccn23)cc1 |
| InChI | InChI=1S/C27H31NO5/c1-25(2,3)23(30)27(24(31)32,26(4,5)6)20-16-18-10-8-9-15-28(18)21(20)22(29)17-11-13-19(33-7)14-12-17/h8-16H,1-7H3,(H,31,32) |
| InChIKey | KEHBODWYWBNTLN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|