C16H14O6 — CID 154168626
2,2-dihydroxy-2-[2-(4-methoxybenzoyl)phenyl]acetic acid (PubChem CID 154168626) has the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. Its IUPAC name is 2,2-dihydroxy-2-[2-(4-methoxybenzoyl)phenyl]acetic acid.
| Compound Name | 2,2-dihydroxy-2-[2-(4-methoxybenzoyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 154168626 |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2,2-dihydroxy-2-[2-(4-methoxybenzoyl)phenyl]acetic acid |
| SMILES | COc1ccc(C(=O)c2ccccc2C(O)(O)C(=O)O)cc1 |
| InChI | InChI=1S/C16H14O6/c1-22-11-8-6-10(7-9-11)14(17)12-4-2-3-5-13(12)16(20,21)15(18)19/h2-9,20-21H,1H3,(H,18,19) |
| InChIKey | OEMJPUPNXJQJFD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|