C21H15NO3 — CID 10711417
3-benzoyl-1,2-dimethylbenzo[f]indole-4,9-dione (PubChem CID 10711417) has the molecular formula C21H15NO3 and a molecular weight of 329.36 g/mol. Its IUPAC name is 3-benzoyl-1,2-dimethylbenzo[f]indole-4,9-dione.
| Compound Name | 3-benzoyl-1,2-dimethylbenzo[f]indole-4,9-dione |
|---|---|
| PubChem CID | 10711417 |
| Molecular Formula | C21H15NO3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 3-benzoyl-1,2-dimethylbenzo[f]indole-4,9-dione |
| SMILES | Cc1c(C(=O)c2ccccc2)c2c(n1C)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H15NO3/c1-12-16(19(23)13-8-4-3-5-9-13)17-18(22(12)2)21(25)15-11-7-6-10-14(15)20(17)24/h3-11H,1-2H3 |
| InChIKey | BARICMTUQUMEPI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|