C16H17NO2 — CID 18719873
1-(5-benzoyl-1,2,4-trimethylpyrrol-3-yl)ethanone (PubChem CID 18719873) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 1-(5-benzoyl-1,2,4-trimethylpyrrol-3-yl)ethanone.
| Compound Name | 1-(5-benzoyl-1,2,4-trimethylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 18719873 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 1-(5-benzoyl-1,2,4-trimethylpyrrol-3-yl)ethanone |
| SMILES | CC(=O)c1c(C)c(C(=O)c2ccccc2)n(C)c1C |
| InChI | InChI=1S/C16H17NO2/c1-10-14(12(3)18)11(2)17(4)15(10)16(19)13-8-6-5-7-9-13/h5-9H,1-4H3 |
| InChIKey | RTMSNPHBUXVUCB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |