C18H19NO3 — CID 804713
2-(3,4-diacetyl-2,5-dimethylpyrrol-1-yl)-1-phenylethanone (PubChem CID 804713) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-(3,4-diacetyl-2,5-dimethylpyrrol-1-yl)-1-phenylethanone.
| Compound Name | 2-(3,4-diacetyl-2,5-dimethylpyrrol-1-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 804713 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-(3,4-diacetyl-2,5-dimethylpyrrol-1-yl)-1-phenylethanone |
| SMILES | CC(=O)c1c(C(C)=O)c(C)n(CC(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C18H19NO3/c1-11-17(13(3)20)18(14(4)21)12(2)19(11)10-16(22)15-8-6-5-7-9-15/h5-9H,10H2,1-4H3 |
| InChIKey | BPIXWEARKBFEIP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |