C10H9N3O — CID 15459293
1-phenyl-2-(1,2,4-triazol-4-yl)ethanone (PubChem CID 15459293) has the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. Its IUPAC name is 1-phenyl-2-(1,2,4-triazol-4-yl)ethanone.
| Compound Name | 1-phenyl-2-(1,2,4-triazol-4-yl)ethanone |
|---|---|
| PubChem CID | 15459293 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 1-phenyl-2-(1,2,4-triazol-4-yl)ethanone |
| SMILES | O=C(Cn1cnnc1)c1ccccc1 |
| InChI | InChI=1S/C10H9N3O/c14-10(6-13-7-11-12-8-13)9-4-2-1-3-5-9/h1-5,7-8H,6H2 |
| InChIKey | WZCIKDJXSQJNIM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |