C14H17ClN2O — CID 87585016
1-phenyl-2-(3,4,5-trimethylimidazol-3-ium-1-yl)ethanone chloride (PubChem CID 87585016) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is 1-phenyl-2-(3,4,5-trimethylimidazol-3-ium-1-yl)ethanone chloride.
| Compound Name | 1-phenyl-2-(3,4,5-trimethylimidazol-3-ium-1-yl)ethanone chloride |
|---|---|
| PubChem CID | 87585016 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1-phenyl-2-(3,4,5-trimethylimidazol-3-ium-1-yl)ethanone chloride |
| SMILES | Cc1c(C)[n+](C)cn1CC(=O)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C14H17N2O.ClH/c1-11-12(2)16(10-15(11)3)9-14(17)13-7-5-4-6-8-13;/h4-8,10H,9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | FODIIWYWISQGDF-UHFFFAOYSA-M |
| XLogP | -1.18 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|