About 1-[2-(4-fluorophenyl)-2-oxoethyl]-3-methylbenzo[f]benzimidazol-3-ium-4,9-dione bromide
1-[2-(4-fluorophenyl)-2-oxoethyl]-3-methylbenzo[f]benzimidazol-3-ium-4,9-dione bromide (PubChem CID 164627397) has the molecular formula C20H14BrFN2O3
and a molecular weight of 429.25 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-2-oxoethyl]-3-methylbenzo[f]benzimidazol-3-ium-4,9-dione bromide.
Molecular Properties
| Compound Name | 1-[2-(4-fluorophenyl)-2-oxoethyl]-3-methylbenzo[f]benzimidazol-3-ium-4,9-dione bromide |
| PubChem CID | 164627397 |
| Molecular Formula | C20H14BrFN2O3 |
| Molecular Weight | 429.25 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-2-oxoethyl]-3-methylbenzo[f]benzimidazol-3-ium-4,9-dione bromide |
| SMILES | C[n+]1cn(CC(=O)c2ccc(F)cc2)c2c1C(=O)c1ccccc1C2=O.[Br-] |
| InChI | InChI=1S/C20H14FN2O3.BrH/c1-22-11-23(10-16(24)12-6-8-13(21)9-7-12)18-17(22)19(25)14-4-2-3-5-15(14)20(18)26;/h2-9,11H,10H2,1H3;1H/q+1;/p-1 |
| InChIKey | DPEBBPWEONLROB-UHFFFAOYSA-M |
| XLogP | -0.89 |
| TPSA | 60.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.25 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(4-fluorophenyl)-2-oxoethyl]-3-methylbenzo[f]benzimidazol-3-ium-4,9-dione bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-fluorophenyl)-2-oxoethyl]-3-methylbenzo[f]benzimidazol-3-ium-4,9-dione bromide?
The IUPAC name of 1-[2-(4-fluorophenyl)-2-oxoethyl]-3-methylbenzo[f]benzimidazol-3-ium-4,9-dione bromide (CID 164627397) is 1-[2-(4-fluorophenyl)-2-oxoethyl]-3-methylbenzo[f]benzimidazol-3-ium-4,9-dione bromide.
What is the SMILES notation for 1-[2-(4-fluorophenyl)-2-oxoethyl]-3-methylbenzo[f]benzimidazol-3-ium-4,9-dione bromide?
The canonical SMILES for 1-[2-(4-fluorophenyl)-2-oxoethyl]-3-methylbenzo[f]benzimidazol-3-ium-4,9-dione bromide is C[n+]1cn(CC(=O)c2ccc(F)cc2)c2c1C(=O)c1ccccc1C2=O.[Br-].
What is the InChIKey of 1-[2-(4-fluorophenyl)-2-oxoethyl]-3-methylbenzo[f]benzimidazol-3-ium-4,9-dione bromide?
The InChIKey is DPEBBPWEONLROB-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H14FN2O3.BrH/c1-22-11-23(10-16(24)12-6-8-13(21)9-7-12)18-17(22)19(25)14-4-2-3-5-15(14)20(18)26;/h2-9,11H,10H2,1H3;1H/q+1;/p-1.
What are the key properties of 1-[2-(4-fluorophenyl)-2-oxoethyl]-3-methylbenzo[f]benzimidazol-3-ium-4,9-dione bromide?
1-[2-(4-fluorophenyl)-2-oxoethyl]-3-methylbenzo[f]benzimidazol-3-ium-4,9-dione bromide has a molecular weight of 429.25 g/mol, XLogP of -0.89, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-fluorophenyl)-2-oxoethyl]-3-methylbenzo[f]benzimidazol-3-ium-4,9-dione bromide is sourced from PubChem (CID 164627397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).