C23H20ClN2O3+ — CID 164614951
3-[2-(4-chlorophenyl)-2-oxoethyl]-1-(2-methylpropyl)benzo[f]benzimidazol-3-ium-4,9-dione (PubChem CID 164614951) has the molecular formula C23H20ClN2O3+ and a molecular weight of 407.88 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)-2-oxoethyl]-1-(2-methylpropyl)benzo[f]benzimidazol-3-ium-4,9-dione.
| Compound Name | 3-[2-(4-chlorophenyl)-2-oxoethyl]-1-(2-methylpropyl)benzo[f]benzimidazol-3-ium-4,9-dione |
|---|---|
| PubChem CID | 164614951 |
| Molecular Formula | C23H20ClN2O3+ |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 3-[2-(4-chlorophenyl)-2-oxoethyl]-1-(2-methylpropyl)benzo[f]benzimidazol-3-ium-4,9-dione |
| SMILES | CC(C)Cn1c[n+](CC(=O)c2ccc(Cl)cc2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H20ClN2O3/c1-14(2)11-25-13-26(12-19(27)15-7-9-16(24)10-8-15)21-20(25)22(28)17-5-3-4-6-18(17)23(21)29/h3-10,13-14H,11-12H2,1-2H3/q+1 |
| InChIKey | VIZZTISCFMQDNQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 60.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|