C9H9ClO — CID 87608045
1-(4-chlorophenyl)-3,3,3-trideuteriopropan-1-one (PubChem CID 87608045) has the molecular formula C9H9ClO and a molecular weight of 171.64 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3,3,3-trideuteriopropan-1-one.
| Compound Name | 1-(4-chlorophenyl)-3,3,3-trideuteriopropan-1-one |
|---|---|
| PubChem CID | 87608045 |
| Molecular Formula | C9H9ClO |
| Molecular Weight | 171.64 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 1-(4-chlorophenyl)-3,3,3-trideuteriopropan-1-one |
| SMILES | [2H]C([2H])([2H])CC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H9ClO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2H2,1H3/i1D3 |
| InChIKey | ADCYRBXQAJXJTD-FIBGUPNXSA-N |
| XLogP | 2.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.64 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |