C19H13ClO4 — CID 53376459
4-[2-(4-chlorophenyl)-2-oxoethoxy]-3-methylnaphthalene-1,2-dione (PubChem CID 53376459) has the molecular formula C19H13ClO4 and a molecular weight of 340.76 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)-2-oxoethoxy]-3-methylnaphthalene-1,2-dione.
| Compound Name | 4-[2-(4-chlorophenyl)-2-oxoethoxy]-3-methylnaphthalene-1,2-dione |
|---|---|
| PubChem CID | 53376459 |
| Molecular Formula | C19H13ClO4 |
| Molecular Weight | 340.76 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 4-[2-(4-chlorophenyl)-2-oxoethoxy]-3-methylnaphthalene-1,2-dione |
| SMILES | CC1=C(OCC(=O)c2ccc(Cl)cc2)c2ccccc2C(=O)C1=O |
| InChI | InChI=1S/C19H13ClO4/c1-11-17(22)18(23)14-4-2-3-5-15(14)19(11)24-10-16(21)12-6-8-13(20)9-7-12/h2-9H,10H2,1H3 |
| InChIKey | KCEWQVGOLRAORV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.76 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|