C27H23N2O3+ — CID 164609892
1-(2-methylpropyl)-3-(2-naphthalen-2-yl-2-oxoethyl)benzo[f]benzimidazol-3-ium-4,9-dione (PubChem CID 164609892) has the molecular formula C27H23N2O3+ and a molecular weight of 423.49 g/mol. Its IUPAC name is 1-(2-methylpropyl)-3-(2-naphthalen-2-yl-2-oxoethyl)benzo[f]benzimidazol-3-ium-4,9-dione.
| Compound Name | 1-(2-methylpropyl)-3-(2-naphthalen-2-yl-2-oxoethyl)benzo[f]benzimidazol-3-ium-4,9-dione |
|---|---|
| PubChem CID | 164609892 |
| Molecular Formula | C27H23N2O3+ |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 1-(2-methylpropyl)-3-(2-naphthalen-2-yl-2-oxoethyl)benzo[f]benzimidazol-3-ium-4,9-dione |
| SMILES | CC(C)Cn1c[n+](CC(=O)c2ccc3ccccc3c2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H23N2O3/c1-17(2)14-28-16-29(15-23(30)20-12-11-18-7-3-4-8-19(18)13-20)25-24(28)26(31)21-9-5-6-10-22(21)27(25)32/h3-13,16-17H,14-15H2,1-2H3/q+1 |
| InChIKey | LJHVCNZKWZCLQP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 60.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|