C9H12ClNO — CID 84660360
1-(5-chloro-1,2,4-trimethylpyrrol-3-yl)ethanone (PubChem CID 84660360) has the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. Its IUPAC name is 1-(5-chloro-1,2,4-trimethylpyrrol-3-yl)ethanone.
| Compound Name | 1-(5-chloro-1,2,4-trimethylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 84660360 |
| Molecular Formula | C9H12ClNO |
| Molecular Weight | 185.65 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 1-(5-chloro-1,2,4-trimethylpyrrol-3-yl)ethanone |
| SMILES | CC(=O)c1c(C)c(Cl)n(C)c1C |
| InChI | InChI=1S/C9H12ClNO/c1-5-8(7(3)12)6(2)11(4)9(5)10/h1-4H3 |
| InChIKey | MJPVPCTWFZKLEF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.65 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |