C14H15NO3 — CID 101445822
3-acetyl-1,2,5,6-tetramethylindole-4,7-dione (PubChem CID 101445822) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-acetyl-1,2,5,6-tetramethylindole-4,7-dione.
| Compound Name | 3-acetyl-1,2,5,6-tetramethylindole-4,7-dione |
|---|---|
| PubChem CID | 101445822 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 3-acetyl-1,2,5,6-tetramethylindole-4,7-dione |
| SMILES | CC(=O)c1c2c(n(C)c1C)C(=O)C(C)=C(C)C2=O |
| InChI | InChI=1S/C14H15NO3/c1-6-7(2)14(18)12-11(13(6)17)10(9(4)16)8(3)15(12)5/h1-5H3 |
| InChIKey | WCUCYDWVKCMMSR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|