C21H14BrNO3 — CID 72702296
3-acetyl-1-(4-bromophenyl)-2-methylbenzo[f]indole-4,9-dione (PubChem CID 72702296) has the molecular formula C21H14BrNO3 and a molecular weight of 408.25 g/mol. Its IUPAC name is 3-acetyl-1-(4-bromophenyl)-2-methylbenzo[f]indole-4,9-dione.
| Compound Name | 3-acetyl-1-(4-bromophenyl)-2-methylbenzo[f]indole-4,9-dione |
|---|---|
| PubChem CID | 72702296 |
| Molecular Formula | C21H14BrNO3 |
| Molecular Weight | 408.25 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | 3-acetyl-1-(4-bromophenyl)-2-methylbenzo[f]indole-4,9-dione |
| SMILES | CC(=O)c1c2c(n(-c3ccc(Br)cc3)c1C)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H14BrNO3/c1-11-17(12(2)24)18-19(23(11)14-9-7-13(22)8-10-14)21(26)16-6-4-3-5-15(16)20(18)25/h3-10H,1-2H3 |
| InChIKey | XDAZGSOAGHJZJP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.25 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|