C25H21NO3 — CID 72702672
3,3-dimethyl-5-(4-methylphenyl)-2,4-dihydrobenzo[b]carbazole-1,6,11-trione (PubChem CID 72702672) has the molecular formula C25H21NO3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 3,3-dimethyl-5-(4-methylphenyl)-2,4-dihydrobenzo[b]carbazole-1,6,11-trione.
| Compound Name | 3,3-dimethyl-5-(4-methylphenyl)-2,4-dihydrobenzo[b]carbazole-1,6,11-trione |
|---|---|
| PubChem CID | 72702672 |
| Molecular Formula | C25H21NO3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 3,3-dimethyl-5-(4-methylphenyl)-2,4-dihydrobenzo[b]carbazole-1,6,11-trione |
| SMILES | Cc1ccc(-n2c3c(c4c2C(=O)c2ccccc2C4=O)C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C25H21NO3/c1-14-8-10-15(11-9-14)26-18-12-25(2,3)13-19(27)20(18)21-22(26)24(29)17-7-5-4-6-16(17)23(21)28/h4-11H,12-13H2,1-3H3 |
| InChIKey | QRQQJTMEZKDWTA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|