C16H8O5 — CID 139833705
11-acetyl-13,14-dioxatetracyclo[8.6.0.03,8.012,15]hexadeca-1(16),3,5,7,10,12(15)-hexaene-2,9-dione (PubChem CID 139833705) has the molecular formula C16H8O5 and a molecular weight of 280.24 g/mol. Its IUPAC name is 11-acetyl-13,14-dioxatetracyclo[8.6.0.03,8.012,15]hexadeca-1(16),3,5,7,10,12(15)-hexaene-2,9-dione.
| Compound Name | 11-acetyl-13,14-dioxatetracyclo[8.6.0.03,8.012,15]hexadeca-1(16),3,5,7,10,12(15)-hexaene-2,9-dione |
|---|---|
| PubChem CID | 139833705 |
| Molecular Formula | C16H8O5 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 11-acetyl-13,14-dioxatetracyclo[8.6.0.03,8.012,15]hexadeca-1(16),3,5,7,10,12(15)-hexaene-2,9-dione |
| SMILES | CC(=O)c1c2c(cc3ooc13)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H8O5/c1-7(17)12-13-10(6-11-16(12)21-20-11)14(18)8-4-2-3-5-9(8)15(13)19/h2-6H,1H3 |
| InChIKey | YSXGNPUFVBAKEB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 77.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|