C21H18O5 — CID 10521813
1-acetyl-2-[(2-methyl-1,3-dioxolan-2-yl)methyl]anthracene-9,10-dione (PubChem CID 10521813) has the molecular formula C21H18O5 and a molecular weight of 350.37 g/mol. Its IUPAC name is 1-acetyl-2-[(2-methyl-1,3-dioxolan-2-yl)methyl]anthracene-9,10-dione.
| Compound Name | 1-acetyl-2-[(2-methyl-1,3-dioxolan-2-yl)methyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 10521813 |
| Molecular Formula | C21H18O5 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1-acetyl-2-[(2-methyl-1,3-dioxolan-2-yl)methyl]anthracene-9,10-dione |
| SMILES | CC(=O)c1c(CC2(C)OCCO2)ccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H18O5/c1-12(22)17-13(11-21(2)25-9-10-26-21)7-8-16-18(17)20(24)15-6-4-3-5-14(15)19(16)23/h3-8H,9-11H2,1-2H3 |
| InChIKey | ITWRANKZOMUJEZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|