C17H10O3S — CID 12996590
2-(hydroxymethyl)naphtho[2,3-g][1]benzothiole-6,11-dione (PubChem CID 12996590) has the molecular formula C17H10O3S and a molecular weight of 294.33 g/mol. Its IUPAC name is 2-(hydroxymethyl)naphtho[2,3-g][1]benzothiole-6,11-dione.
| Compound Name | 2-(hydroxymethyl)naphtho[2,3-g][1]benzothiole-6,11-dione |
|---|---|
| PubChem CID | 12996590 |
| Molecular Formula | C17H10O3S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 2-(hydroxymethyl)naphtho[2,3-g][1]benzothiole-6,11-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc1cc(CO)sc21 |
| InChI | InChI=1S/C17H10O3S/c18-8-10-7-9-5-6-13-14(17(9)21-10)16(20)12-4-2-1-3-11(12)15(13)19/h1-7,18H,8H2 |
| InChIKey | ZUWWOJKPFVQHMR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|