C17H10O — CID 22413
benzo[c]fluoren-7-one (PubChem CID 22413) has the molecular formula C17H10O and a molecular weight of 230.27 g/mol. Its IUPAC name is benzo[c]fluoren-7-one.
| Compound Name | benzo[c]fluoren-7-one |
|---|---|
| PubChem CID | 22413 |
| Molecular Formula | C17H10O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | benzo[c]fluoren-7-one |
| SMILES | O=C1c2ccccc2-c2c1ccc1ccccc21 |
| InChI | InChI=1S/C17H10O/c18-17-14-8-4-3-7-13(14)16-12-6-2-1-5-11(12)9-10-15(16)17/h1-10H |
| InChIKey | USYWCEDYVLPNHH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |