C28H14O6 — CID 10343512
3-(1,2,4-trioxophenanthren-3-yl)phenanthrene-1,2,4-trione (PubChem CID 10343512) has the molecular formula C28H14O6 and a molecular weight of 446.41 g/mol. Its IUPAC name is 3-(1,2,4-trioxophenanthren-3-yl)phenanthrene-1,2,4-trione.
| Compound Name | 3-(1,2,4-trioxophenanthren-3-yl)phenanthrene-1,2,4-trione |
|---|---|
| PubChem CID | 10343512 |
| Molecular Formula | C28H14O6 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 3-(1,2,4-trioxophenanthren-3-yl)phenanthrene-1,2,4-trione |
| SMILES | O=C1C(=O)C(C2C(=O)C(=O)c3ccc4ccccc4c3C2=O)C(=O)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C28H14O6/c29-23-17-11-9-13-5-1-3-7-15(13)19(17)25(31)21(27(23)33)22-26(32)20-16-8-4-2-6-14(16)10-12-18(20)24(30)28(22)34/h1-12,21-22H |
| InChIKey | GXWLAIGPEALQKM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|