C18H10O2 — CID 169434082
8,9,10,11-tetradeuteriobenzo[a]anthracene-7,12-dione (PubChem CID 169434082) has the molecular formula C18H10O2 and a molecular weight of 262.30 g/mol. Its IUPAC name is 8,9,10,11-tetradeuteriobenzo[a]anthracene-7,12-dione.
| Compound Name | 8,9,10,11-tetradeuteriobenzo[a]anthracene-7,12-dione |
|---|---|
| PubChem CID | 169434082 |
| Molecular Formula | C18H10O2 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 8,9,10,11-tetradeuteriobenzo[a]anthracene-7,12-dione |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])C(=O)c1ccc3ccccc3c1C2=O |
| InChI | InChI=1S/C18H10O2/c19-17-13-7-3-4-8-14(13)18(20)16-12-6-2-1-5-11(12)9-10-15(16)17/h1-10H/i3D,4D,7D,8D |
| InChIKey | LHMRXAIRPKSGDE-KNIGXJNHSA-N |
| XLogP | 3.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|