About benzo[b]fluorene-11-thione;benzo[c]fluoren-7-one
benzo[b]fluorene-11-thione;benzo[c]fluoren-7-one (PubChem CID 159467800) has the molecular formula C34H20OS
and a molecular weight of 476.60 g/mol. Its IUPAC name is benzo[b]fluorene-11-thione;benzo[c]fluoren-7-one.
Molecular Properties
| Compound Name | benzo[b]fluorene-11-thione;benzo[c]fluoren-7-one |
| PubChem CID | 159467800 |
| Molecular Formula | C34H20OS |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | benzo[b]fluorene-11-thione;benzo[c]fluoren-7-one |
| SMILES | O=C1c2ccccc2-c2c1ccc1ccccc21.S=C1c2ccccc2-c2cc3ccccc3cc21 |
| InChI | InChI=1S/C17H10O.C17H10S/c18-17-14-8-4-3-7-13(14)16-12-6-2-1-5-11(12)9-10-15(16)17;18-17-14-8-4-3-7-13(14)15-9-11-5-1-2-6-12(11)10-16(15)17/h2*1-10H |
| InChIKey | LVKITSQCJUHTDP-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze benzo[b]fluorene-11-thione;benzo[c]fluoren-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[b]fluorene-11-thione;benzo[c]fluoren-7-one?
The IUPAC name of benzo[b]fluorene-11-thione;benzo[c]fluoren-7-one (CID 159467800) is benzo[b]fluorene-11-thione;benzo[c]fluoren-7-one.
What is the SMILES notation for benzo[b]fluorene-11-thione;benzo[c]fluoren-7-one?
The canonical SMILES for benzo[b]fluorene-11-thione;benzo[c]fluoren-7-one is O=C1c2ccccc2-c2c1ccc1ccccc21.S=C1c2ccccc2-c2cc3ccccc3cc21.
What is the InChIKey of benzo[b]fluorene-11-thione;benzo[c]fluoren-7-one?
The InChIKey is LVKITSQCJUHTDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10O.C17H10S/c18-17-14-8-4-3-7-13(14)16-12-6-2-1-5-11(12)9-10-15(16)17;18-17-14-8-4-3-7-13(14)15-9-11-5-1-2-6-12(11)10-16(15)17/h2*1-10H.
What are the key properties of benzo[b]fluorene-11-thione;benzo[c]fluoren-7-one?
benzo[b]fluorene-11-thione;benzo[c]fluoren-7-one has a molecular weight of 476.60 g/mol, XLogP of 8.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[b]fluorene-11-thione;benzo[c]fluoren-7-one is sourced from PubChem (CID 159467800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).