C22H19BrO6 — CID 10837601
2-bromo-1-hydroxy-3-[4-(2-methyl-1,3-dioxolan-2-yl)-3-oxobutyl]anthracene-9,10-dione (PubChem CID 10837601) has the molecular formula C22H19BrO6 and a molecular weight of 459.29 g/mol. Its IUPAC name is 2-bromo-1-hydroxy-3-[4-(2-methyl-1,3-dioxolan-2-yl)-3-oxobutyl]anthracene-9,10-dione.
| Compound Name | 2-bromo-1-hydroxy-3-[4-(2-methyl-1,3-dioxolan-2-yl)-3-oxobutyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 10837601 |
| Molecular Formula | C22H19BrO6 |
| Molecular Weight | 459.29 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | 2-bromo-1-hydroxy-3-[4-(2-methyl-1,3-dioxolan-2-yl)-3-oxobutyl]anthracene-9,10-dione |
| SMILES | CC1(CC(=O)CCc2cc3c(c(O)c2Br)C(=O)c2ccccc2C3=O)OCCO1 |
| InChI | InChI=1S/C22H19BrO6/c1-22(28-8-9-29-22)11-13(24)7-6-12-10-16-17(21(27)18(12)23)20(26)15-5-3-2-4-14(15)19(16)25/h2-5,10,27H,6-9,11H2,1H3 |
| InChIKey | MYNFJSFDYKFKLG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|