C19H16O5 — CID 86122272
1-hydroxy-3-(hydroxymethyl)-2-(3-oxobutyl)anthracene-9,10-dione (PubChem CID 86122272) has the molecular formula C19H16O5 and a molecular weight of 324.33 g/mol. Its IUPAC name is 1-hydroxy-3-(hydroxymethyl)-2-(3-oxobutyl)anthracene-9,10-dione.
| Compound Name | 1-hydroxy-3-(hydroxymethyl)-2-(3-oxobutyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 86122272 |
| Molecular Formula | C19H16O5 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 1-hydroxy-3-(hydroxymethyl)-2-(3-oxobutyl)anthracene-9,10-dione |
| SMILES | CC(=O)CCc1c(CO)cc2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H16O5/c1-10(21)6-7-12-11(9-20)8-15-16(18(12)23)19(24)14-5-3-2-4-13(14)17(15)22/h2-5,8,20,23H,6-7,9H2,1H3 |
| InChIKey | IXHZSUYKYBHKBL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|