C21H19NO8 — CID 67652104
3-[2-carboxyethyl-[(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)methyl]amino]propanoic acid (PubChem CID 67652104) has the molecular formula C21H19NO8 and a molecular weight of 413.38 g/mol. Its IUPAC name is 3-[2-carboxyethyl-[(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)methyl]amino]propanoic acid.
| Compound Name | 3-[2-carboxyethyl-[(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67652104 |
| Molecular Formula | C21H19NO8 |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 3-[2-carboxyethyl-[(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)methyl]amino]propanoic acid |
| SMILES | O=C(O)CCN(CCC(=O)O)Cc1cc2c(c(O)c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H19NO8/c23-15(24)5-7-22(8-6-16(25)26)10-11-9-14-17(21(30)18(11)27)20(29)13-4-2-1-3-12(13)19(14)28/h1-4,9,27,30H,5-8,10H2,(H,23,24)(H,25,26) |
| InChIKey | BWCLEWJOIFGULL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 152.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|