C32H46BrNO4 — CID 162675743
(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl-methyl-dioctylazanium bromide (PubChem CID 162675743) has the molecular formula C32H46BrNO4 and a molecular weight of 588.63 g/mol. Its IUPAC name is (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl-methyl-dioctylazanium bromide.
| Compound Name | (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl-methyl-dioctylazanium bromide |
|---|---|
| PubChem CID | 162675743 |
| Molecular Formula | C32H46BrNO4 |
| Molecular Weight | 588.63 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | (4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methyl-methyl-dioctylazanium bromide |
| SMILES | CCCCCCCC[N+](C)(CCCCCCCC)Cc1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O.[Br-] |
| InChI | InChI=1S/C32H45NO4.BrH/c1-4-6-8-10-12-14-19-33(3,20-15-13-11-9-7-5-2)23-24-21-26-30(28(35)22-24)32(37)29-25(31(26)36)17-16-18-27(29)34;/h16-18,21-22H,4-15,19-20,23H2,1-3H3,(H-,34,35,37);1H |
| InChIKey | GNDNLXMRVJWHLS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|