C18H14O6 — CID 10735496
3,8-dihydroxy-9,10-dioxo-1-(213C)propylanthracene-2-carboxylic acid (PubChem CID 10735496) has the molecular formula C18H14O6 and a molecular weight of 335.24 g/mol. Its IUPAC name is 3,8-dihydroxy-9,10-dioxo-1-(213C)propylanthracene-2-carboxylic acid.
| Compound Name | 3,8-dihydroxy-9,10-dioxo-1-(213C)propylanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 10735496 |
| Molecular Formula | C18H14O6 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 3,8-dihydroxy-9,10-dioxo-1-(213C)propylanthracene-2-carboxylic acid |
| SMILES | C[13CH2]C[13c]1c([13C](=O)O)[13c](O)c[13c]2c1[13C](=O)c1[13c](O)c[13cH]c[13c]1C2=O |
| InChI | InChI=1S/C18H14O6/c1-2-4-8-13-10(7-12(20)15(8)18(23)24)16(21)9-5-3-6-11(19)14(9)17(13)22/h3,5-7,19-20H,2,4H2,1H3,(H,23,24)/i2+1,3+1,8+1,9+1,10+1,11+1,12+1,17+1,18+1 |
| InChIKey | FNFBCXUSCQLQFP-WADLBRTLSA-N |
| XLogP | 2.52 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|