C18H12O7 — CID 54597552
4-ethoxycarbonyl-8-hydroxy-9,10-dioxoanthracene-2-carboxylic acid (PubChem CID 54597552) has the molecular formula C18H12O7 and a molecular weight of 340.29 g/mol. Its IUPAC name is 4-ethoxycarbonyl-8-hydroxy-9,10-dioxoanthracene-2-carboxylic acid.
| Compound Name | 4-ethoxycarbonyl-8-hydroxy-9,10-dioxoanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 54597552 |
| Molecular Formula | C18H12O7 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 4-ethoxycarbonyl-8-hydroxy-9,10-dioxoanthracene-2-carboxylic acid |
| SMILES | CCOC(=O)c1cc(C(=O)O)cc2c1C(=O)c1cccc(O)c1C2=O |
| InChI | InChI=1S/C18H12O7/c1-2-25-18(24)11-7-8(17(22)23)6-10-13(11)15(20)9-4-3-5-12(19)14(9)16(10)21/h3-7,19H,2H2,1H3,(H,22,23) |
| InChIKey | VHBBNZOLKSMMFC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|