C20H16O6 — CID 170644964
5-hydroxy-9,10-dioxo-4-pent-4-enoxyanthracene-2-carboxylic acid (PubChem CID 170644964) has the molecular formula C20H16O6 and a molecular weight of 352.34 g/mol. Its IUPAC name is 5-hydroxy-9,10-dioxo-4-pent-4-enoxyanthracene-2-carboxylic acid.
| Compound Name | 5-hydroxy-9,10-dioxo-4-pent-4-enoxyanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 170644964 |
| Molecular Formula | C20H16O6 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 5-hydroxy-9,10-dioxo-4-pent-4-enoxyanthracene-2-carboxylic acid |
| SMILES | C=CCCCOc1cc(C(=O)O)cc2c1C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C20H16O6/c1-2-3-4-8-26-15-10-11(20(24)25)9-13-17(15)19(23)16-12(18(13)22)6-5-7-14(16)21/h2,5-7,9-10,21H,1,3-4,8H2,(H,24,25) |
| InChIKey | NNRMBQJDGFJKJS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|