C15H8O12S2 — CID 71752060
9,10-dioxo-4,5-disulfooxyanthracene-2-carboxylic acid (PubChem CID 71752060) has the molecular formula C15H8O12S2 and a molecular weight of 444.35 g/mol. Its IUPAC name is 9,10-dioxo-4,5-disulfooxyanthracene-2-carboxylic acid.
| Compound Name | 9,10-dioxo-4,5-disulfooxyanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 71752060 |
| Molecular Formula | C15H8O12S2 |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 443.95 |
| IUPAC Name | 9,10-dioxo-4,5-disulfooxyanthracene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(OS(=O)(=O)O)c2c(c1)C(=O)c1cccc(OS(=O)(=O)O)c1C2=O |
| InChI | InChI=1S/C15H8O12S2/c16-13-7-2-1-3-9(26-28(20,21)22)11(7)14(17)12-8(13)4-6(15(18)19)5-10(12)27-29(23,24)25/h1-5H,(H,18,19)(H,20,21,22)(H,23,24,25) |
| InChIKey | RYQCYAMIJLHXBC-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 198.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|