C15H8MgO6+2 — CID 42646237
magnesium 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid (PubChem CID 42646237) has the molecular formula C15H8MgO6+2 and a molecular weight of 308.53 g/mol. Its IUPAC name is magnesium 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid.
| Compound Name | magnesium 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 42646237 |
| Molecular Formula | C15H8MgO6+2 |
| Molecular Weight | 308.53 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | magnesium 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O.[Mg+2] |
| InChI | InChI=1S/C15H8O6.Mg/c16-9-3-1-2-7-11(9)14(19)12-8(13(7)18)4-6(15(20)21)5-10(12)17;/h1-5,16-17H,(H,20,21);/q;+2 |
| InChIKey | MMFBUSPKWAYJAQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.53 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|