C30H16O12 — CID 159899695
4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid (PubChem CID 159899695) has the molecular formula C30H16O12 and a molecular weight of 568.45 g/mol. Its IUPAC name is 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid.
| Compound Name | 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 159899695 |
| Molecular Formula | C30H16O12 |
| Molecular Weight | 568.45 g/mol |
| Exact Mass | 568.06 |
| IUPAC Name | 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O.O=C(O)c1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O |
| InChI | InChI=1S/2C15H8O6/c2*16-9-3-1-2-7-11(9)14(19)12-8(13(7)18)4-6(15(20)21)5-10(12)17/h2*1-5,16-17H,(H,20,21) |
| InChIKey | NVUIYGHTTAHEOY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|