C15H7KO6 — CID 42646236
potassium 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate (PubChem CID 42646236) has the molecular formula C15H7KO6 and a molecular weight of 322.31 g/mol. Its IUPAC name is potassium 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | potassium 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 42646236 |
| Molecular Formula | C15H7KO6 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | potassium 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate |
| SMILES | O=C([O-])c1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O.[K+] |
| InChI | InChI=1S/C15H8O6.K/c16-9-3-1-2-7-11(9)14(19)12-8(13(7)18)4-6(15(20)21)5-10(12)17;/h1-5,16-17H,(H,20,21);/q;+1/p-1 |
| InChIKey | LWPGRSNVEOCTSS-UHFFFAOYSA-M |
| XLogP | -2.76 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|