C42H34CaO22 — CID 146156489
calcium bis(4-hydroxy-9,10-dioxo-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracene-2-carboxylate) (PubChem CID 146156489) has the molecular formula C42H34CaO22 and a molecular weight of 930.79 g/mol. Its IUPAC name is calcium bis(4-hydroxy-9,10-dioxo-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracene-2-carboxylate).
| Compound Name | calcium bis(4-hydroxy-9,10-dioxo-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracene-2-carboxylate) |
|---|---|
| PubChem CID | 146156489 |
| Molecular Formula | C42H34CaO22 |
| Molecular Weight | 930.79 g/mol |
| Exact Mass | 930.12 |
| IUPAC Name | calcium bis(4-hydroxy-9,10-dioxo-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracene-2-carboxylate) |
| SMILES | O=C([O-])c1cc(O)c2c(c1)C(=O)c1cccc(OC3OC(CO)C(O)C(O)C3O)c1C2=O.O=C([O-])c1cc(O)c2c(c1)C(=O)c1cccc(OC3OC(CO)C(O)C(O)C3O)c1C2=O.[Ca+2] |
| InChI | InChI=1S/2C21H18O11.Ca/c2*22-6-12-16(25)18(27)19(28)21(32-12)31-11-3-1-2-8-14(11)17(26)13-9(15(8)24)4-7(20(29)30)5-10(13)23;/h2*1-5,12,16,18-19,21-23,25,27-28H,6H2,(H,29,30);/q;;+2/p-2 |
| InChIKey | AZVJESIQTIROTM-UHFFFAOYSA-L |
| XLogP | -4.96 |
| TPSA | 387.76 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.79 |
| LogP ≤ 5 | -4.96 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|