C23H18O14 — CID 162981115
4-hydroxy-9,10-dioxo-5-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(oxalooxymethyl)oxan-2-yl]oxyanthracene-2-carboxylic acid (PubChem CID 162981115) has the molecular formula C23H18O14 and a molecular weight of 518.38 g/mol. Its IUPAC name is 4-hydroxy-9,10-dioxo-5-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(oxalooxymethyl)oxan-2-yl]oxyanthracene-2-carboxylic acid.
| Compound Name | 4-hydroxy-9,10-dioxo-5-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(oxalooxymethyl)oxan-2-yl]oxyanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 162981115 |
| Molecular Formula | C23H18O14 |
| Molecular Weight | 518.38 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | 4-hydroxy-9,10-dioxo-5-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(oxalooxymethyl)oxan-2-yl]oxyanthracene-2-carboxylic acid |
| SMILES | O=C(O)C(=O)OC[C@H]1O[C@@H](Oc2cccc3c2C(=O)c2c(O)cc(C(=O)O)cc2C3=O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C23H18O14/c24-10-5-7(20(30)31)4-9-13(10)17(27)14-8(15(9)25)2-1-3-11(14)36-23-19(29)18(28)16(26)12(37-23)6-35-22(34)21(32)33/h1-5,12,16,18-19,23-24,26,28-29H,6H2,(H,30,31)(H,32,33)/t12-,16+,18-,19-,23-/m1/s1 |
| InChIKey | DQJNCXBYABUAPU-WTYIQBFZSA-N |
| XLogP | -1.32 |
| TPSA | 234.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.38 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|