C23H17NO6 — CID 168785712
4,5-dihydroxy-N-[(4-methoxyphenyl)methyl]-9,10-dioxoanthracene-2-carboxamide (PubChem CID 168785712) has the molecular formula C23H17NO6 and a molecular weight of 403.39 g/mol. Its IUPAC name is 4,5-dihydroxy-N-[(4-methoxyphenyl)methyl]-9,10-dioxoanthracene-2-carboxamide.
| Compound Name | 4,5-dihydroxy-N-[(4-methoxyphenyl)methyl]-9,10-dioxoanthracene-2-carboxamide |
|---|---|
| PubChem CID | 168785712 |
| Molecular Formula | C23H17NO6 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 4,5-dihydroxy-N-[(4-methoxyphenyl)methyl]-9,10-dioxoanthracene-2-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2cc(O)c3c(c2)C(=O)c2cccc(O)c2C3=O)cc1 |
| InChI | InChI=1S/C23H17NO6/c1-30-14-7-5-12(6-8-14)11-24-23(29)13-9-16-20(18(26)10-13)22(28)19-15(21(16)27)3-2-4-17(19)25/h2-10,25-26H,11H2,1H3,(H,24,29) |
| InChIKey | LKARTHJJRCRQKW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|