C23H19NO3S — CID 147568072
N-[(4-methoxyphenyl)methyl]-6-oxo-5H-benzo[b][1]benzothiepine-3-carboxamide (PubChem CID 147568072) has the molecular formula C23H19NO3S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-6-oxo-5H-benzo[b][1]benzothiepine-3-carboxamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-6-oxo-5H-benzo[b][1]benzothiepine-3-carboxamide |
|---|---|
| PubChem CID | 147568072 |
| Molecular Formula | C23H19NO3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-6-oxo-5H-benzo[b][1]benzothiepine-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2ccc3c(c2)CC(=O)c2ccccc2S3)cc1 |
| InChI | InChI=1S/C23H19NO3S/c1-27-18-9-6-15(7-10-18)14-24-23(26)16-8-11-21-17(12-16)13-20(25)19-4-2-3-5-22(19)28-21/h2-12H,13-14H2,1H3,(H,24,26) |
| InChIKey | FTYUTIAMKKVGRX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |