C31H27BrN2O6 — CID 175336365
4,5-dihydroxy-N-[3-[1-[(4-methoxyphenyl)methyl]pyridin-1-ium-4-yl]propyl]-9,10-dioxoanthracene-2-carboxamide bromide (PubChem CID 175336365) has the molecular formula C31H27BrN2O6 and a molecular weight of 603.47 g/mol. Its IUPAC name is 4,5-dihydroxy-N-[3-[1-[(4-methoxyphenyl)methyl]pyridin-1-ium-4-yl]propyl]-9,10-dioxoanthracene-2-carboxamide bromide.
| Compound Name | 4,5-dihydroxy-N-[3-[1-[(4-methoxyphenyl)methyl]pyridin-1-ium-4-yl]propyl]-9,10-dioxoanthracene-2-carboxamide bromide |
|---|---|
| PubChem CID | 175336365 |
| Molecular Formula | C31H27BrN2O6 |
| Molecular Weight | 603.47 g/mol |
| Exact Mass | 602.11 |
| IUPAC Name | 4,5-dihydroxy-N-[3-[1-[(4-methoxyphenyl)methyl]pyridin-1-ium-4-yl]propyl]-9,10-dioxoanthracene-2-carboxamide bromide |
| SMILES | COc1ccc(C[n+]2ccc(CCCNC(=O)c3cc(O)c4c(c3)C(=O)c3cccc(O)c3C4=O)cc2)cc1.[Br-] |
| InChI | InChI=1S/C31H26N2O6.BrH/c1-39-22-9-7-20(8-10-22)18-33-14-11-19(12-15-33)4-3-13-32-31(38)21-16-24-28(26(35)17-21)30(37)27-23(29(24)36)5-2-6-25(27)34;/h2,5-12,14-17H,3-4,13,18H2,1H3,(H2-,32,34,35,37,38);1H |
| InChIKey | WWTQHGXEYAITRU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.47 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|