C26H24BrN3O4 — CID 162672649
6-methoxy-N-[2-[1-[(2-nitrophenyl)methyl]pyridin-1-ium-4-yl]ethyl]naphthalene-2-carboxamide bromide (PubChem CID 162672649) has the molecular formula C26H24BrN3O4 and a molecular weight of 522.40 g/mol. Its IUPAC name is 6-methoxy-N-[2-[1-[(2-nitrophenyl)methyl]pyridin-1-ium-4-yl]ethyl]naphthalene-2-carboxamide bromide.
| Compound Name | 6-methoxy-N-[2-[1-[(2-nitrophenyl)methyl]pyridin-1-ium-4-yl]ethyl]naphthalene-2-carboxamide bromide |
|---|---|
| PubChem CID | 162672649 |
| Molecular Formula | C26H24BrN3O4 |
| Molecular Weight | 522.40 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | 6-methoxy-N-[2-[1-[(2-nitrophenyl)methyl]pyridin-1-ium-4-yl]ethyl]naphthalene-2-carboxamide bromide |
| SMILES | COc1ccc2cc(C(=O)NCCc3cc[n+](Cc4ccccc4[N+](=O)[O-])cc3)ccc2c1.[Br-] |
| InChI | InChI=1S/C26H23N3O4.BrH/c1-33-24-9-8-20-16-22(7-6-21(20)17-24)26(30)27-13-10-19-11-14-28(15-12-19)18-23-4-2-3-5-25(23)29(31)32;/h2-9,11-12,14-17H,10,13,18H2,1H3;1H |
| InChIKey | YYOFSNGMUVTWCL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.40 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|