C30H17ClO9 — CID 90871622
2-chloro-7-(1,8-dihydroxy-3-methyl-9,10-dioxoanthracen-2-yl)-1,3,8-trihydroxy-6-methylanthracene-9,10-dione (PubChem CID 90871622) has the molecular formula C30H17ClO9 and a molecular weight of 556.91 g/mol. Its IUPAC name is 2-chloro-7-(1,8-dihydroxy-3-methyl-9,10-dioxoanthracen-2-yl)-1,3,8-trihydroxy-6-methylanthracene-9,10-dione.
| Compound Name | 2-chloro-7-(1,8-dihydroxy-3-methyl-9,10-dioxoanthracen-2-yl)-1,3,8-trihydroxy-6-methylanthracene-9,10-dione |
|---|---|
| PubChem CID | 90871622 |
| Molecular Formula | C30H17ClO9 |
| Molecular Weight | 556.91 g/mol |
| Exact Mass | 556.06 |
| IUPAC Name | 2-chloro-7-(1,8-dihydroxy-3-methyl-9,10-dioxoanthracen-2-yl)-1,3,8-trihydroxy-6-methylanthracene-9,10-dione |
| SMILES | Cc1cc2c(c(O)c1-c1c(C)cc3c(c1O)C(=O)c1c(cc(O)c(Cl)c1O)C3=O)C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C30H17ClO9/c1-9-6-12-20(28(38)19-11(24(12)34)4-3-5-15(19)32)26(36)17(9)18-10(2)7-13-21(27(18)37)29(39)22-14(25(13)35)8-16(33)23(31)30(22)40/h3-8,32-33,36-37,40H,1-2H3 |
| InChIKey | ZZEMICZHPYOWFC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.91 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|