C23H20O8 — CID 11293169
4,5-di(butanoyloxy)-9,10-dioxoanthracene-2-carboxylic acid (PubChem CID 11293169) has the molecular formula C23H20O8 and a molecular weight of 424.41 g/mol. Its IUPAC name is 4,5-di(butanoyloxy)-9,10-dioxoanthracene-2-carboxylic acid.
| Compound Name | 4,5-di(butanoyloxy)-9,10-dioxoanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 11293169 |
| Molecular Formula | C23H20O8 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 4,5-di(butanoyloxy)-9,10-dioxoanthracene-2-carboxylic acid |
| SMILES | CCCC(=O)Oc1cccc2c1C(=O)c1c(OC(=O)CCC)cc(C(=O)O)cc1C2=O |
| InChI | InChI=1S/C23H20O8/c1-3-6-17(24)30-15-9-5-8-13-19(15)22(27)20-14(21(13)26)10-12(23(28)29)11-16(20)31-18(25)7-4-2/h5,8-11H,3-4,6-7H2,1-2H3,(H,28,29) |
| InChIKey | WFLXMEXTPQNPFY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|