C19H14O4 — CID 18175784
(9,10-dioxoanthracen-1-yl) 2-methylidenebutanoate (PubChem CID 18175784) has the molecular formula C19H14O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is (9,10-dioxoanthracen-1-yl) 2-methylidenebutanoate.
| Compound Name | (9,10-dioxoanthracen-1-yl) 2-methylidenebutanoate |
|---|---|
| PubChem CID | 18175784 |
| Molecular Formula | C19H14O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (9,10-dioxoanthracen-1-yl) 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)Oc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H14O4/c1-3-11(2)19(22)23-15-10-6-9-14-16(15)18(21)13-8-5-4-7-12(13)17(14)20/h4-10H,2-3H2,1H3 |
| InChIKey | NJWMYRDWLBXPNK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|