C30H20O6 — CID 11134561
[5-(4-methylbenzoyl)oxy-9,10-dioxoanthracen-1-yl] 4-methylbenzoate (PubChem CID 11134561) has the molecular formula C30H20O6 and a molecular weight of 476.48 g/mol. Its IUPAC name is [5-(4-methylbenzoyl)oxy-9,10-dioxoanthracen-1-yl] 4-methylbenzoate.
| Compound Name | [5-(4-methylbenzoyl)oxy-9,10-dioxoanthracen-1-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 11134561 |
| Molecular Formula | C30H20O6 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | [5-(4-methylbenzoyl)oxy-9,10-dioxoanthracen-1-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2cccc3c2C(=O)c2cccc(OC(=O)c4ccc(C)cc4)c2C3=O)cc1 |
| InChI | InChI=1S/C30H20O6/c1-17-9-13-19(14-10-17)29(33)35-23-7-3-5-21-25(23)27(31)22-6-4-8-24(26(22)28(21)32)36-30(34)20-15-11-18(2)12-16-20/h3-16H,1-2H3 |
| InChIKey | DDVPKYAXLZBBBV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|